C14H17NO2 — CID 141121514
1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol (PubChem CID 141121514) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol.
| Compound Name | 1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
|---|---|
| PubChem CID | 141121514 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
| SMILES | COC1C(O)CCC2N=Cc3ccccc3C21 |
| InChI | InChI=1S/C14H17NO2/c1-17-14-12(16)7-6-11-13(14)10-5-3-2-4-9(10)8-15-11/h2-5,8,11-14,16H,6-7H2,1H3 |
| InChIKey | ZDTDTUXOZZIFAA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |