C14H17NO5S — CID 141121528
(1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) hydrogen sulfate (PubChem CID 141121528) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is (1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) hydrogen sulfate.
| Compound Name | (1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 141121528 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) hydrogen sulfate |
| SMILES | COC1C(OS(=O)(=O)O)CCC2N=Cc3ccccc3C21 |
| InChI | InChI=1S/C14H17NO5S/c1-19-14-12(20-21(16,17)18)7-6-11-13(14)10-5-3-2-4-9(10)8-15-11/h2-5,8,11-14H,6-7H2,1H3,(H,16,17,18) |
| InChIKey | FGYWHUFYXRPHLX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|