C14H17NO3S — CID 141121529
1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl methanesulfonate (PubChem CID 141121529) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl methanesulfonate.
| Compound Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl methanesulfonate |
|---|---|
| PubChem CID | 141121529 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCC2N=Cc3ccccc3C2C1 |
| InChI | InChI=1S/C14H17NO3S/c1-19(16,17)18-11-6-7-14-13(8-11)12-5-3-2-4-10(12)9-15-14/h2-5,9,11,13-14H,6-8H2,1H3 |
| InChIKey | QTHLIKQAMKNBKB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|