C15H19NO4S — CID 141121515
(1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) methanesulfonate (PubChem CID 141121515) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) methanesulfonate.
| Compound Name | (1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) methanesulfonate |
|---|---|
| PubChem CID | 141121515 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (1-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) methanesulfonate |
| SMILES | COC1C(OS(C)(=O)=O)CCC2N=Cc3ccccc3C21 |
| InChI | InChI=1S/C15H19NO4S/c1-19-15-13(20-21(2,17)18)8-7-12-14(15)11-6-4-3-5-10(11)9-16-12/h3-6,9,12-15H,7-8H2,1-2H3 |
| InChIKey | XTTPYBCUVFNLRJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|