C15H19NO3S — CID 141150418
1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl ethanesulfonate (PubChem CID 141150418) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl ethanesulfonate.
| Compound Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl ethanesulfonate |
|---|---|
| PubChem CID | 141150418 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl ethanesulfonate |
| SMILES | CCS(=O)(=O)OC1CCC2N=Cc3ccccc3C2C1 |
| InChI | InChI=1S/C15H19NO3S/c1-2-20(17,18)19-12-7-8-15-14(9-12)13-6-4-3-5-11(13)10-16-15/h3-6,10,12,14-15H,2,7-9H2,1H3 |
| InChIKey | ZDZJXKOFYWEYFM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|