C20H21NO3S — CID 141150429
1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl phenylmethanesulfonate (PubChem CID 141150429) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl phenylmethanesulfonate.
| Compound Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl phenylmethanesulfonate |
|---|---|
| PubChem CID | 141150429 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl phenylmethanesulfonate |
| SMILES | O=S(=O)(Cc1ccccc1)OC1CCC2N=Cc3ccccc3C2C1 |
| InChI | InChI=1S/C20H21NO3S/c22-25(23,14-15-6-2-1-3-7-15)24-17-10-11-20-19(12-17)18-9-5-4-8-16(18)13-21-20/h1-9,13,17,19-20H,10-12,14H2 |
| InChIKey | JLKMWZOPUXPYHD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|