C15H19NO2 — CID 139929330
1,1-dimethoxy-3,4,4a,10b-tetrahydro-2H-phenanthridine (PubChem CID 139929330) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 1,1-dimethoxy-3,4,4a,10b-tetrahydro-2H-phenanthridine.
| Compound Name | 1,1-dimethoxy-3,4,4a,10b-tetrahydro-2H-phenanthridine |
|---|---|
| PubChem CID | 139929330 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1,1-dimethoxy-3,4,4a,10b-tetrahydro-2H-phenanthridine |
| SMILES | COC1(OC)CCCC2N=Cc3ccccc3C21 |
| InChI | InChI=1S/C15H19NO2/c1-17-15(18-2)9-5-8-13-14(15)12-7-4-3-6-11(12)10-16-13/h3-4,6-7,10,13-14H,5,8-9H2,1-2H3 |
| InChIKey | ZPRDAPPBRQZUOD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|