C22H25F3N2 — CID 141150782
3-(2,2-difluoroethyl)-4-(2-ethylbutyl)-6-fluoro-4-phenylquinazoline (PubChem CID 141150782) has the molecular formula C22H25F3N2 and a molecular weight of 374.45 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-4-(2-ethylbutyl)-6-fluoro-4-phenylquinazoline.
| Compound Name | 3-(2,2-difluoroethyl)-4-(2-ethylbutyl)-6-fluoro-4-phenylquinazoline |
|---|---|
| PubChem CID | 141150782 |
| Molecular Formula | C22H25F3N2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 3-(2,2-difluoroethyl)-4-(2-ethylbutyl)-6-fluoro-4-phenylquinazoline |
| SMILES | CCC(CC)CC1(c2ccccc2)c2cc(F)ccc2N=CN1CC(F)F |
| InChI | InChI=1S/C22H25F3N2/c1-3-16(4-2)13-22(17-8-6-5-7-9-17)19-12-18(23)10-11-20(19)26-15-27(22)14-21(24)25/h5-12,15-16,21H,3-4,13-14H2,1-2H3 |
| InChIKey | UFDKGEPWTKASOV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |