C19H17F3N2O — CID 59346591
3-(2,2-difluoroethyl)-6-fluoro-4-phenyl-4-prop-1-en-2-yl-1H-quinazolin-2-one (PubChem CID 59346591) has the molecular formula C19H17F3N2O and a molecular weight of 346.35 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-6-fluoro-4-phenyl-4-prop-1-en-2-yl-1H-quinazolin-2-one.
| Compound Name | 3-(2,2-difluoroethyl)-6-fluoro-4-phenyl-4-prop-1-en-2-yl-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 59346591 |
| Molecular Formula | C19H17F3N2O |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-(2,2-difluoroethyl)-6-fluoro-4-phenyl-4-prop-1-en-2-yl-1H-quinazolin-2-one |
| SMILES | C=C(C)C1(c2ccccc2)c2cc(F)ccc2NC(=O)N1CC(F)F |
| InChI | InChI=1S/C19H17F3N2O/c1-12(2)19(13-6-4-3-5-7-13)15-10-14(20)8-9-16(15)23-18(25)24(19)11-17(21)22/h3-10,17H,1,11H2,2H3,(H,23,25) |
| InChIKey | MWCHJDQFVMGCQN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|