C19H30N2O3 — CID 141150970
1-[[3-ethoxy-5-(oxan-4-yloxy)phenyl]methyl]piperidin-4-amine (PubChem CID 141150970) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[[3-ethoxy-5-(oxan-4-yloxy)phenyl]methyl]piperidin-4-amine.
| Compound Name | 1-[[3-ethoxy-5-(oxan-4-yloxy)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 141150970 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[[3-ethoxy-5-(oxan-4-yloxy)phenyl]methyl]piperidin-4-amine |
| SMILES | CCOc1cc(CN2CCC(N)CC2)cc(OC2CCOCC2)c1 |
| InChI | InChI=1S/C19H30N2O3/c1-2-23-18-11-15(14-21-7-3-16(20)4-8-21)12-19(13-18)24-17-5-9-22-10-6-17/h11-13,16-17H,2-10,14,20H2,1H3 |
| InChIKey | PNQAFKUESQJGKY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |