C18H28N2OSi — CID 141151716
1-(4-tert-butylphenyl)-3-[1-[ethynyl(dimethyl)silyl]propan-2-yl]urea (PubChem CID 141151716) has the molecular formula C18H28N2OSi and a molecular weight of 316.52 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[1-[ethynyl(dimethyl)silyl]propan-2-yl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[1-[ethynyl(dimethyl)silyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 141151716 |
| Molecular Formula | C18H28N2OSi |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[1-[ethynyl(dimethyl)silyl]propan-2-yl]urea |
| SMILES | C#C[Si](C)(C)CC(C)NC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28N2OSi/c1-8-22(6,7)13-14(2)19-17(21)20-16-11-9-15(10-12-16)18(3,4)5/h1,9-12,14H,13H2,2-7H3,(H2,19,20,21) |
| InChIKey | OORFDBWIYFFMBK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|