C15H21F2NO3 — CID 141152201
2-(difluoromethyl)-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide (PubChem CID 141152201) has the molecular formula C15H21F2NO3 and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-(difluoromethyl)-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide.
| Compound Name | 2-(difluoromethyl)-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 141152201 |
| Molecular Formula | C15H21F2NO3 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-(difluoromethyl)-3-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cccc(C(=O)NC(C)C)c1C(F)F |
| InChI | InChI=1S/C15H21F2NO3/c1-10(2)18-15(19)11-6-4-7-12(13(11)14(16)17)21-9-5-8-20-3/h4,6-7,10,14H,5,8-9H2,1-3H3,(H,18,19) |
| InChIKey | BEDGGFLFACTCTQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|