C18H34N2O5 — CID 141155010
tert-butyl N-hydroxy-N-[5-methyl-4-(oxan-4-ylcarbamoyl)hexyl]carbamate (PubChem CID 141155010) has the molecular formula C18H34N2O5 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl N-hydroxy-N-[5-methyl-4-(oxan-4-ylcarbamoyl)hexyl]carbamate.
| Compound Name | tert-butyl N-hydroxy-N-[5-methyl-4-(oxan-4-ylcarbamoyl)hexyl]carbamate |
|---|---|
| PubChem CID | 141155010 |
| Molecular Formula | C18H34N2O5 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | tert-butyl N-hydroxy-N-[5-methyl-4-(oxan-4-ylcarbamoyl)hexyl]carbamate |
| SMILES | CC(C)C(CCCN(O)C(=O)OC(C)(C)C)C(=O)NC1CCOCC1 |
| InChI | InChI=1S/C18H34N2O5/c1-13(2)15(16(21)19-14-8-11-24-12-9-14)7-6-10-20(23)17(22)25-18(3,4)5/h13-15,23H,6-12H2,1-5H3,(H,19,21) |
| InChIKey | FFLPMGLWLDFKRI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|