C12H25N3O — CID 141156018
4-(dipropylamino)-N',N'-dimethylbut-2-enehydrazide (PubChem CID 141156018) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-(dipropylamino)-N',N'-dimethylbut-2-enehydrazide.
| Compound Name | 4-(dipropylamino)-N',N'-dimethylbut-2-enehydrazide |
|---|---|
| PubChem CID | 141156018 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 4-(dipropylamino)-N',N'-dimethylbut-2-enehydrazide |
| SMILES | CCCN(CC=CC(=O)NN(C)C)CCC |
| InChI | InChI=1S/C12H25N3O/c1-5-9-15(10-6-2)11-7-8-12(16)13-14(3)4/h7-8H,5-6,9-11H2,1-4H3,(H,13,16) |
| InChIKey | VNAXOARUCAHUBS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|