C8H16N2O — CID 54303069
4-(diethylamino)but-2-enamide (PubChem CID 54303069) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 4-(diethylamino)but-2-enamide.
| Compound Name | 4-(diethylamino)but-2-enamide |
|---|---|
| PubChem CID | 54303069 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 4-(diethylamino)but-2-enamide |
| SMILES | CCN(CC)CC=CC(N)=O |
| InChI | InChI=1S/C8H16N2O/c1-3-10(4-2)7-5-6-8(9)11/h5-6H,3-4,7H2,1-2H3,(H2,9,11) |
| InChIKey | SFPGNABUJLHMNQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|