C28H18N4OS — CID 141156860
2-[5-(furan-2-yl)-4-(1H-indol-2-yl)-2-pyridin-2-ylthiophen-3-yl]-1H-benzimidazole (PubChem CID 141156860) has the molecular formula C28H18N4OS and a molecular weight of 458.55 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-4-(1H-indol-2-yl)-2-pyridin-2-ylthiophen-3-yl]-1H-benzimidazole.
| Compound Name | 2-[5-(furan-2-yl)-4-(1H-indol-2-yl)-2-pyridin-2-ylthiophen-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 141156860 |
| Molecular Formula | C28H18N4OS |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-[5-(furan-2-yl)-4-(1H-indol-2-yl)-2-pyridin-2-ylthiophen-3-yl]-1H-benzimidazole |
| SMILES | c1ccc(-c2sc(-c3ccco3)c(-c3cc4ccccc4[nH]3)c2-c2nc3ccccc3[nH]2)nc1 |
| InChI | InChI=1S/C28H18N4OS/c1-2-9-18-17(8-1)16-22(30-18)24-25(28-31-19-10-3-4-11-20(19)32-28)26(21-12-5-6-14-29-21)34-27(24)23-13-7-15-33-23/h1-16,30H,(H,31,32) |
| InChIKey | LWOUQFLHZGAZLF-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |