C20H29NO6S — CID 141159334
(2S)-2-benzyl-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-sulfanylpropanoic acid (PubChem CID 141159334) has the molecular formula C20H29NO6S and a molecular weight of 411.52 g/mol. Its IUPAC name is (2S)-2-benzyl-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-benzyl-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 141159334 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (2S)-2-benzyl-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)[C@@](CS)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H29NO6S/c1-18(2,3)26-16(24)21(17(25)27-19(4,5)6)20(13-28,15(22)23)12-14-10-8-7-9-11-14/h7-11,28H,12-13H2,1-6H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | WFLAYLAUTZGSMX-HXUWFJFHSA-N |
| XLogP | 4.15 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|