C19H22N4O3S — CID 141160863
1-[(4-methoxyphenyl)methyl]-6-methylsulfanyl-3-[(4-nitrophenyl)methyl]-2,4-dihydro-1,3,5-triazine (PubChem CID 141160863) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-6-methylsulfanyl-3-[(4-nitrophenyl)methyl]-2,4-dihydro-1,3,5-triazine.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-6-methylsulfanyl-3-[(4-nitrophenyl)methyl]-2,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 141160863 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-6-methylsulfanyl-3-[(4-nitrophenyl)methyl]-2,4-dihydro-1,3,5-triazine |
| SMILES | COc1ccc(CN2CN(Cc3ccc([N+](=O)[O-])cc3)CN=C2SC)cc1 |
| InChI | InChI=1S/C19H22N4O3S/c1-26-18-9-5-16(6-10-18)12-22-14-21(13-20-19(22)27-2)11-15-3-7-17(8-4-15)23(24)25/h3-10H,11-14H2,1-2H3 |
| InChIKey | OPJXZLMFTHHAKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|