C33H38N6O4 — CID 141162601
(2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]-tritylamino]hexanoic acid (PubChem CID 141162601) has the molecular formula C33H38N6O4 and a molecular weight of 582.71 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]-tritylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]-tritylamino]hexanoic acid |
|---|---|
| PubChem CID | 141162601 |
| Molecular Formula | C33H38N6O4 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]-tritylamino]hexanoic acid |
| SMILES | NCCCC[C@@H](C(=O)O)N(C(=O)[C@H](Cc1cnc[nH]1)NC(=O)CN)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38N6O4/c34-19-11-10-18-29(32(42)43)39(31(41)28(38-30(40)21-35)20-27-22-36-23-37-27)33(24-12-4-1-5-13-24,25-14-6-2-7-15-25)26-16-8-3-9-17-26/h1-9,12-17,22-23,28-29H,10-11,18-21,34-35H2,(H,36,37)(H,38,40)(H,42,43)/t28-,29-/m0/s1 |
| InChIKey | INNCJIPCLDZHLL-VMPREFPWSA-N |
| XLogP | 2.80 |
| TPSA | 167.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|