C17H17ClN2O2S — CID 141163503
1-(4-tert-butylphenyl)sulfonyl-5-chloropyrrolo[3,2-b]pyridine (PubChem CID 141163503) has the molecular formula C17H17ClN2O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-5-chloropyrrolo[3,2-b]pyridine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-5-chloropyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 141163503 |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-5-chloropyrrolo[3,2-b]pyridine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)n2ccc3nc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C17H17ClN2O2S/c1-17(2,3)12-4-6-13(7-5-12)23(21,22)20-11-10-14-15(20)8-9-16(18)19-14/h4-11H,1-3H3 |
| InChIKey | QGBRYCMYWFXMMU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|