C23H18N4O2S — CID 102164331
N-[1-(benzenesulfonyl)pyrrolo[3,2-b]pyridin-5-yl]-2-methylquinolin-4-amine (PubChem CID 102164331) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[1-(benzenesulfonyl)pyrrolo[3,2-b]pyridin-5-yl]-2-methylquinolin-4-amine.
| Compound Name | N-[1-(benzenesulfonyl)pyrrolo[3,2-b]pyridin-5-yl]-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 102164331 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[1-(benzenesulfonyl)pyrrolo[3,2-b]pyridin-5-yl]-2-methylquinolin-4-amine |
| SMILES | Cc1cc(Nc2ccc3c(ccn3S(=O)(=O)c3ccccc3)n2)c2ccccc2n1 |
| InChI | InChI=1S/C23H18N4O2S/c1-16-15-21(18-9-5-6-10-19(18)24-16)26-23-12-11-22-20(25-23)13-14-27(22)30(28,29)17-7-3-2-4-8-17/h2-15H,1H3,(H,24,25,26) |
| InChIKey | WHOSHJJGSASDIX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |