C11H7FN2OS — CID 141163644
6-fluoro-2-(furan-2-ylsulfanyl)-1H-benzimidazole (PubChem CID 141163644) has the molecular formula C11H7FN2OS and a molecular weight of 234.26 g/mol. Its IUPAC name is 6-fluoro-2-(furan-2-ylsulfanyl)-1H-benzimidazole.
| Compound Name | 6-fluoro-2-(furan-2-ylsulfanyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 141163644 |
| Molecular Formula | C11H7FN2OS |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 6-fluoro-2-(furan-2-ylsulfanyl)-1H-benzimidazole |
| SMILES | Fc1ccc2nc(Sc3ccco3)[nH]c2c1 |
| InChI | InChI=1S/C11H7FN2OS/c12-7-3-4-8-9(6-7)14-11(13-8)16-10-2-1-5-15-10/h1-6H,(H,13,14) |
| InChIKey | PHQGCRYLBSMSHJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |