C16H12F3N3O3S2 — CID 141164540
N-[6-[[4-(trifluoromethyl)phenyl]sulfamoyl]-1,3-benzothiazol-2-yl]acetamide (PubChem CID 141164540) has the molecular formula C16H12F3N3O3S2 and a molecular weight of 415.42 g/mol. Its IUPAC name is N-[6-[[4-(trifluoromethyl)phenyl]sulfamoyl]-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[6-[[4-(trifluoromethyl)phenyl]sulfamoyl]-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 141164540 |
| Molecular Formula | C16H12F3N3O3S2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-[6-[[4-(trifluoromethyl)phenyl]sulfamoyl]-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3)cc2s1 |
| InChI | InChI=1S/C16H12F3N3O3S2/c1-9(23)20-15-21-13-7-6-12(8-14(13)26-15)27(24,25)22-11-4-2-10(3-5-11)16(17,18)19/h2-8,22H,1H3,(H,20,21,23) |
| InChIKey | UCOVWSZDIQTMOK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |