C8H10N4OS2 — CID 141164875
6-ethylimidazo[1,2-b]pyridazine-3-sulfonothioamide (PubChem CID 141164875) has the molecular formula C8H10N4OS2 and a molecular weight of 242.33 g/mol. Its IUPAC name is 6-ethylimidazo[1,2-b]pyridazine-3-sulfonothioamide.
| Compound Name | 6-ethylimidazo[1,2-b]pyridazine-3-sulfonothioamide |
|---|---|
| PubChem CID | 141164875 |
| Molecular Formula | C8H10N4OS2 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 6-ethylimidazo[1,2-b]pyridazine-3-sulfonothioamide |
| SMILES | CCc1ccc2ncc(S(N)(=O)=S)n2n1 |
| InChI | InChI=1S/C8H10N4OS2/c1-2-6-3-4-7-10-5-8(12(7)11-6)15(9,13)14/h3-5H,2H2,1H3,(H2,9,13,14) |
| InChIKey | QRSKTJKIQSVYDJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |