C28H38N2O — CID 141165369
1-[3-[4-[4-[(Z)-3-piperidin-3-ylprop-1-enyl]phenyl]phenoxy]propyl]piperidine (PubChem CID 141165369) has the molecular formula C28H38N2O and a molecular weight of 418.63 g/mol. Its IUPAC name is 1-[3-[4-[4-[(Z)-3-piperidin-3-ylprop-1-enyl]phenyl]phenoxy]propyl]piperidine.
| Compound Name | 1-[3-[4-[4-[(Z)-3-piperidin-3-ylprop-1-enyl]phenyl]phenoxy]propyl]piperidine |
|---|---|
| PubChem CID | 141165369 |
| Molecular Formula | C28H38N2O |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | 1-[3-[4-[4-[(Z)-3-piperidin-3-ylprop-1-enyl]phenyl]phenoxy]propyl]piperidine |
| SMILES | C(=C\c1ccc(-c2ccc(OCCCN3CCCCC3)cc2)cc1)\CC1CCCNC1 |
| InChI | InChI=1S/C28H38N2O/c1-2-19-30(20-3-1)21-6-22-31-28-16-14-27(15-17-28)26-12-10-24(11-13-26)7-4-8-25-9-5-18-29-23-25/h4,7,10-17,25,29H,1-3,5-6,8-9,18-23H2/b7-4- |
| InChIKey | KRIXPOUIOMSSEZ-DAXSKMNVSA-N |
| XLogP | 6.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|