C6H10N2O2 — CID 141166031
methyl 2-methyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 141166031) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is methyl 2-methyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | methyl 2-methyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 141166031 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | methyl 2-methyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | COC(=O)C1=NN(C)CC1 |
| InChI | InChI=1S/C6H10N2O2/c1-8-4-3-5(7-8)6(9)10-2/h3-4H2,1-2H3 |
| InChIKey | JNKVBIOOMSOLNA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |