About methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate
methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 20662589) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate |
| PubChem CID | 20662589 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCN1N=C(C(=O)OC)CC1C |
| InChI | InChI=1S/C8H14N2O2/c1-4-10-6(2)5-7(9-10)8(11)12-3/h6H,4-5H2,1-3H3 |
| InChIKey | ZVQCOVHRTKSAOM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate?
The IUPAC name of methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate (CID 20662589) is methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate.
What is the SMILES notation for methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate?
The canonical SMILES for methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate is CCN1N=C(C(=O)OC)CC1C.
What is the InChIKey of methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate?
The InChIKey is ZVQCOVHRTKSAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-4-10-6(2)5-7(9-10)8(11)12-3/h6H,4-5H2,1-3H3.
What are the key properties of methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate?
methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate has a molecular weight of 170.21 g/mol, XLogP of 0.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-3-methyl-3,4-dihydropyrazole-5-carboxylate is sourced from PubChem (CID 20662589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).