C14H19N3O5 — CID 141169457
(3S)-3-amino-4-[2-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]hydrazinyl]-4-oxobutanoic acid (PubChem CID 141169457) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is (3S)-3-amino-4-[2-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]hydrazinyl]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[2-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]hydrazinyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141169457 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (3S)-3-amino-4-[2-[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]hydrazinyl]-4-oxobutanoic acid |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NNC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C14H19N3O5/c1-22-14(21)11(7-9-5-3-2-4-6-9)16-17-13(20)10(15)8-12(18)19/h2-6,10-11,16H,7-8,15H2,1H3,(H,17,20)(H,18,19)/t10-,11-/m0/s1 |
| InChIKey | NNXXYGWIOKBKGH-QWRGUYRKSA-N |
| XLogP | -0.81 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|