C27H32O5Si — CID 141170369
[2-(2-ethyl-1,3-dioxan-2-yl)phenoxy]-diphenoxy-propylsilane (PubChem CID 141170369) has the molecular formula C27H32O5Si and a molecular weight of 464.63 g/mol. Its IUPAC name is [2-(2-ethyl-1,3-dioxan-2-yl)phenoxy]-diphenoxy-propylsilane.
| Compound Name | [2-(2-ethyl-1,3-dioxan-2-yl)phenoxy]-diphenoxy-propylsilane |
|---|---|
| PubChem CID | 141170369 |
| Molecular Formula | C27H32O5Si |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [2-(2-ethyl-1,3-dioxan-2-yl)phenoxy]-diphenoxy-propylsilane |
| SMILES | CCC[Si](Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1C1(CC)OCCCO1 |
| InChI | InChI=1S/C27H32O5Si/c1-3-22-33(30-23-14-7-5-8-15-23,31-24-16-9-6-10-17-24)32-26-19-12-11-18-25(26)27(4-2)28-20-13-21-29-27/h5-12,14-19H,3-4,13,20-22H2,1-2H3 |
| InChIKey | NWPCYMFYIITIEZ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|