C23H22N4S — CID 141175166
6-[4-[(4-phenylpiperazin-1-yl)methyl]phenyl]thieno[3,2-d]pyrimidine (PubChem CID 141175166) has the molecular formula C23H22N4S and a molecular weight of 386.52 g/mol. Its IUPAC name is 6-[4-[(4-phenylpiperazin-1-yl)methyl]phenyl]thieno[3,2-d]pyrimidine.
| Compound Name | 6-[4-[(4-phenylpiperazin-1-yl)methyl]phenyl]thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 141175166 |
| Molecular Formula | C23H22N4S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 6-[4-[(4-phenylpiperazin-1-yl)methyl]phenyl]thieno[3,2-d]pyrimidine |
| SMILES | c1ccc(N2CCN(Cc3ccc(-c4cc5ncncc5s4)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H22N4S/c1-2-4-20(5-3-1)27-12-10-26(11-13-27)16-18-6-8-19(9-7-18)22-14-21-23(28-22)15-24-17-25-21/h1-9,14-15,17H,10-13,16H2 |
| InChIKey | BCVFLSWFWMVBRT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |