C9H11N3OS — CID 141175204
3-[(E)-2-[(5R)-5-methyl-2,5-dihydro-1H-pyrrol-3-yl]ethenyl]-2H-1,2,4-oxadiazole-5-thione (PubChem CID 141175204) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-[(E)-2-[(5R)-5-methyl-2,5-dihydro-1H-pyrrol-3-yl]ethenyl]-2H-1,2,4-oxadiazole-5-thione.
| Compound Name | 3-[(E)-2-[(5R)-5-methyl-2,5-dihydro-1H-pyrrol-3-yl]ethenyl]-2H-1,2,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 141175204 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 3-[(E)-2-[(5R)-5-methyl-2,5-dihydro-1H-pyrrol-3-yl]ethenyl]-2H-1,2,4-oxadiazole-5-thione |
| SMILES | C[C@@H]1C=C(/C=C/c2nc(=S)o[nH]2)CN1 |
| InChI | InChI=1S/C9H11N3OS/c1-6-4-7(5-10-6)2-3-8-11-9(14)13-12-8/h2-4,6,10H,5H2,1H3,(H,11,12,14)/b3-2+/t6-/m1/s1 |
| InChIKey | PGSZKDRZACDZJE-YRFDSLTASA-N |
| XLogP | 1.66 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|