C8H11N3OS — CID 141175216
3-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]-2H-1,2,4-oxadiazole-5-thione (PubChem CID 141175216) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]-2H-1,2,4-oxadiazole-5-thione.
| Compound Name | 3-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]-2H-1,2,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 141175216 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 3-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]-2H-1,2,4-oxadiazole-5-thione |
| SMILES | C[C@@H]1C=C(c2nc(=S)o[nH]2)CCN1 |
| InChI | InChI=1S/C8H11N3OS/c1-5-4-6(2-3-9-5)7-10-8(13)12-11-7/h4-5,9H,2-3H2,1H3,(H,10,11,13)/t5-/m1/s1 |
| InChIKey | NVQTXLXQAABNPR-RXMQYKEDSA-N |
| XLogP | 1.50 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|