C15H18BrF3N2O3 — CID 141176281
[4-[[4-bromo-2-(trifluoromethoxy)phenyl]methylamino]cyclohexyl]carbamic acid (PubChem CID 141176281) has the molecular formula C15H18BrF3N2O3 and a molecular weight of 411.22 g/mol. Its IUPAC name is [4-[[4-bromo-2-(trifluoromethoxy)phenyl]methylamino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[4-bromo-2-(trifluoromethoxy)phenyl]methylamino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 141176281 |
| Molecular Formula | C15H18BrF3N2O3 |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | [4-[[4-bromo-2-(trifluoromethoxy)phenyl]methylamino]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCC(NCc2ccc(Br)cc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H18BrF3N2O3/c16-10-2-1-9(13(7-10)24-15(17,18)19)8-20-11-3-5-12(6-4-11)21-14(22)23/h1-2,7,11-12,20-21H,3-6,8H2,(H,22,23) |
| InChIKey | VGLMLVHFKWCXIU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |