C21H31N3 — CID 141177032
1-[4-(4-methyl-2,3-dihydropyrrol-1-yl)-2-piperidin-1-ylphenyl]piperidine (PubChem CID 141177032) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-[4-(4-methyl-2,3-dihydropyrrol-1-yl)-2-piperidin-1-ylphenyl]piperidine.
| Compound Name | 1-[4-(4-methyl-2,3-dihydropyrrol-1-yl)-2-piperidin-1-ylphenyl]piperidine |
|---|---|
| PubChem CID | 141177032 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 1-[4-(4-methyl-2,3-dihydropyrrol-1-yl)-2-piperidin-1-ylphenyl]piperidine |
| SMILES | CC1=CN(c2ccc(N3CCCCC3)c(N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C21H31N3/c1-18-10-15-24(17-18)19-8-9-20(22-11-4-2-5-12-22)21(16-19)23-13-6-3-7-14-23/h8-9,16-17H,2-7,10-15H2,1H3 |
| InChIKey | XEMRDJXNSVZICP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|