C26H36BrN3OSi — CID 141177361
4-[[[(Z)-(6-bromo-3H-isoquinolin-4-ylidene)methyl]amino]methyl]-2-tri(propan-2-yl)silyloxyaniline (PubChem CID 141177361) has the molecular formula C26H36BrN3OSi and a molecular weight of 514.58 g/mol. Its IUPAC name is 4-[[[(Z)-(6-bromo-3H-isoquinolin-4-ylidene)methyl]amino]methyl]-2-tri(propan-2-yl)silyloxyaniline.
| Compound Name | 4-[[[(Z)-(6-bromo-3H-isoquinolin-4-ylidene)methyl]amino]methyl]-2-tri(propan-2-yl)silyloxyaniline |
|---|---|
| PubChem CID | 141177361 |
| Molecular Formula | C26H36BrN3OSi |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 4-[[[(Z)-(6-bromo-3H-isoquinolin-4-ylidene)methyl]amino]methyl]-2-tri(propan-2-yl)silyloxyaniline |
| SMILES | CC(C)[Si](Oc1cc(CN/C=C2\CN=Cc3ccc(Br)cc32)ccc1N)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H36BrN3OSi/c1-17(2)32(18(3)4,19(5)6)31-26-11-20(7-10-25(26)28)13-29-15-22-16-30-14-21-8-9-23(27)12-24(21)22/h7-12,14-15,17-19,29H,13,16,28H2,1-6H3/b22-15+ |
| InChIKey | FXGQQDJCIAPRMS-PXLXIMEGSA-N |
| XLogP | 7.15 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|