C20H19BrN2O2 — CID 69174094
5-[[(6-bromo-1H-isoquinolin-4-ylidene)methylamino]methyl]-2-prop-2-enoxyphenol (PubChem CID 69174094) has the molecular formula C20H19BrN2O2 and a molecular weight of 399.29 g/mol. Its IUPAC name is 5-[[(6-bromo-1H-isoquinolin-4-ylidene)methylamino]methyl]-2-prop-2-enoxyphenol.
| Compound Name | 5-[[(6-bromo-1H-isoquinolin-4-ylidene)methylamino]methyl]-2-prop-2-enoxyphenol |
|---|---|
| PubChem CID | 69174094 |
| Molecular Formula | C20H19BrN2O2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 5-[[(6-bromo-1H-isoquinolin-4-ylidene)methylamino]methyl]-2-prop-2-enoxyphenol |
| SMILES | C=CCOc1ccc(CNC=C2C=NCc3ccc(Br)cc32)cc1O |
| InChI | InChI=1S/C20H19BrN2O2/c1-2-7-25-20-6-3-14(8-19(20)24)10-22-12-16-13-23-11-15-4-5-17(21)9-18(15)16/h2-6,8-9,12-13,22,24H,1,7,10-11H2 |
| InChIKey | PTXWGOYIFNKRFU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|