C29H29N5 — CID 141177542
N-[[6-(1H-indol-5-yl)-3H-isoquinolin-4-ylidene]methyl]-4-(4-methylpiperazin-1-yl)aniline (PubChem CID 141177542) has the molecular formula C29H29N5 and a molecular weight of 447.59 g/mol. Its IUPAC name is N-[[6-(1H-indol-5-yl)-3H-isoquinolin-4-ylidene]methyl]-4-(4-methylpiperazin-1-yl)aniline.
| Compound Name | N-[[6-(1H-indol-5-yl)-3H-isoquinolin-4-ylidene]methyl]-4-(4-methylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 141177542 |
| Molecular Formula | C29H29N5 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | N-[[6-(1H-indol-5-yl)-3H-isoquinolin-4-ylidene]methyl]-4-(4-methylpiperazin-1-yl)aniline |
| SMILES | CN1CCN(c2ccc(NC=C3CN=Cc4ccc(-c5ccc6[nH]ccc6c5)cc43)cc2)CC1 |
| InChI | InChI=1S/C29H29N5/c1-33-12-14-34(15-13-33)27-7-5-26(6-8-27)32-20-25-19-30-18-24-3-2-22(17-28(24)25)21-4-9-29-23(16-21)10-11-31-29/h2-11,16-18,20,31-32H,12-15,19H2,1H3 |
| InChIKey | ZPMQXLALKNNSLA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|