C26H32N4O — CID 141177485
5-[4-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-3H-isoquinolin-6-yl]pent-4-en-1-ol (PubChem CID 141177485) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 5-[4-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-3H-isoquinolin-6-yl]pent-4-en-1-ol.
| Compound Name | 5-[4-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-3H-isoquinolin-6-yl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 141177485 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 5-[4-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-3H-isoquinolin-6-yl]pent-4-en-1-ol |
| SMILES | CN1CCN(c2ccc(NC=C3CN=Cc4ccc(C=CCCCO)cc43)cc2)CC1 |
| InChI | InChI=1S/C26H32N4O/c1-29-12-14-30(15-13-29)25-10-8-24(9-11-25)28-20-23-19-27-18-22-7-6-21(17-26(22)23)5-3-2-4-16-31/h3,5-11,17-18,20,28,31H,2,4,12-16,19H2,1H3 |
| InChIKey | NOYZWDIMOKOFIV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|