C22H23N7O — CID 174106389
5-(indazol-5-ylidenemethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-1H-imidazol-4-ol (PubChem CID 174106389) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 5-(indazol-5-ylidenemethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-1H-imidazol-4-ol.
| Compound Name | 5-(indazol-5-ylidenemethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-1H-imidazol-4-ol |
|---|---|
| PubChem CID | 174106389 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 5-(indazol-5-ylidenemethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-1H-imidazol-4-ol |
| SMILES | CN1CCN(c2ccc(Nc3nc(O)c(C=c4ccc5c(c4)C=NN=5)[nH]3)cc2)CC1 |
| InChI | InChI=1S/C22H23N7O/c1-28-8-10-29(11-9-28)18-5-3-17(4-6-18)24-22-25-20(21(30)26-22)13-15-2-7-19-16(12-15)14-23-27-19/h2-7,12-14,30H,8-11H2,1H3,(H2,24,25,26) |
| InChIKey | VIQHUUNYDHOIMP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|