C27H17F3N2OS — CID 141182002
5-[naphthalen-2-yl(phenyl)methylidene]-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 141182002) has the molecular formula C27H17F3N2OS and a molecular weight of 474.51 g/mol. Its IUPAC name is 5-[naphthalen-2-yl(phenyl)methylidene]-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[naphthalen-2-yl(phenyl)methylidene]-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 141182002 |
| Molecular Formula | C27H17F3N2OS |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 5-[naphthalen-2-yl(phenyl)methylidene]-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2cccc(C(F)(F)F)c2)SC1=C(c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H17F3N2OS/c28-27(29,30)21-11-6-12-22(16-21)31-26-32-25(33)24(34-26)23(18-8-2-1-3-9-18)20-14-13-17-7-4-5-10-19(17)15-20/h1-16H,(H,31,32,33) |
| InChIKey | ATUYEXRYFKFPPQ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|