C29H19ClN2OS — CID 141435110
2-(4-chlorophenyl)imino-5-[9H-fluoren-1-yl(phenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 141435110) has the molecular formula C29H19ClN2OS and a molecular weight of 479.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)imino-5-[9H-fluoren-1-yl(phenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-chlorophenyl)imino-5-[9H-fluoren-1-yl(phenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 141435110 |
| Molecular Formula | C29H19ClN2OS |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-(4-chlorophenyl)imino-5-[9H-fluoren-1-yl(phenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2)SC1=C(c1ccccc1)c1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C29H19ClN2OS/c30-20-13-15-21(16-14-20)31-29-32-28(33)27(34-29)26(18-7-2-1-3-8-18)24-12-6-11-23-22-10-5-4-9-19(22)17-25(23)24/h1-16H,17H2,(H,31,32,33) |
| InChIKey | AYWOUZRFXFTVRM-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|