C19H15N3O5S — CID 135834650
5-[[(5Z)-5-[1-(3-aminophenyl)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid (PubChem CID 135834650) has the molecular formula C19H15N3O5S and a molecular weight of 397.41 g/mol. Its IUPAC name is 5-[[(5Z)-5-[1-(3-aminophenyl)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[(5Z)-5-[1-(3-aminophenyl)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 135834650 |
| Molecular Formula | C19H15N3O5S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 5-[[(5Z)-5-[1-(3-aminophenyl)ethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylic acid |
| SMILES | C/C(=C1/S/C(=N/c2cc(C(=O)O)cc(C(=O)O)c2)NC1=O)c1cccc(N)c1 |
| InChI | InChI=1S/C19H15N3O5S/c1-9(10-3-2-4-13(20)6-10)15-16(23)22-19(28-15)21-14-7-11(17(24)25)5-12(8-14)18(26)27/h2-8H,20H2,1H3,(H,24,25)(H,26,27)(H,21,22,23)/b15-9- |
| InChIKey | ZRLSBOPLWSRFRI-DHDCSXOGSA-N |
| XLogP | 2.95 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|