C9H13FN4O — CID 141182437
2-[(3R)-3-aminopiperidin-1-yl]-5-fluoro-1H-pyrimidin-6-one (PubChem CID 141182437) has the molecular formula C9H13FN4O and a molecular weight of 212.23 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-5-fluoro-1H-pyrimidin-6-one.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-fluoro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 141182437 |
| Molecular Formula | C9H13FN4O |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-fluoro-1H-pyrimidin-6-one |
| SMILES | N[C@@H]1CCCN(c2ncc(F)c(=O)[nH]2)C1 |
| InChI | InChI=1S/C9H13FN4O/c10-7-4-12-9(13-8(7)15)14-3-1-2-6(11)5-14/h4,6H,1-3,5,11H2,(H,12,13,15)/t6-/m1/s1 |
| InChIKey | AUWYERGJHYSEDO-ZCFIWIBFSA-N |
| XLogP | -0.16 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |