About N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine
N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 141182723) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine.
Analyze N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine?
The IUPAC name of N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine (CID 141182723) is N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine is CCN(CC)C1(C)C=CC=CC1C.
What is the InChIKey of N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine?
The InChIKey is SZFJKXHDCAULDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-5-13(6-2)12(4)10-8-7-9-11(12)3/h7-11H,5-6H2,1-4H3.
What are the key properties of N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine?
N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine has a molecular weight of 179.31 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-1,6-dimethylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 141182723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).