About 1-phosphonooxydecyl prop-2-enoate
1-phosphonooxydecyl prop-2-enoate (PubChem CID 141182725) has the molecular formula C13H25O6P
and a molecular weight of 308.31 g/mol. Its IUPAC name is 1-phosphonooxydecyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-phosphonooxydecyl prop-2-enoate |
| PubChem CID | 141182725 |
| Molecular Formula | C13H25O6P |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-phosphonooxydecyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CCCCCCCCC)OP(=O)(O)O |
| InChI | InChI=1S/C13H25O6P/c1-3-5-6-7-8-9-10-11-13(18-12(14)4-2)19-20(15,16)17/h4,13H,2-3,5-11H2,1H3,(H2,15,16,17) |
| InChIKey | GMANPWVOMLGLLB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-phosphonooxydecyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phosphonooxydecyl prop-2-enoate?
The IUPAC name of 1-phosphonooxydecyl prop-2-enoate (CID 141182725) is 1-phosphonooxydecyl prop-2-enoate.
What is the SMILES notation for 1-phosphonooxydecyl prop-2-enoate?
The canonical SMILES for 1-phosphonooxydecyl prop-2-enoate is C=CC(=O)OC(CCCCCCCCC)OP(=O)(O)O.
What is the InChIKey of 1-phosphonooxydecyl prop-2-enoate?
The InChIKey is GMANPWVOMLGLLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25O6P/c1-3-5-6-7-8-9-10-11-13(18-12(14)4-2)19-20(15,16)17/h4,13H,2-3,5-11H2,1H3,(H2,15,16,17).
What are the key properties of 1-phosphonooxydecyl prop-2-enoate?
1-phosphonooxydecyl prop-2-enoate has a molecular weight of 308.31 g/mol, XLogP of 3.29, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phosphonooxydecyl prop-2-enoate is sourced from PubChem (CID 141182725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).