C22H16N8O3S2 — CID 141183862
2-[1-(4,5-dihydro-1,3-oxazol-2-yl)-5-(1,2-oxazol-3-yl)-3-(1H-pyrrol-2-yl)-2-(1,2-thiazol-3-yl)-4-(1,3-thiazol-2-yl)imidazol-2-yl]-1,3-oxazole (PubChem CID 141183862) has the molecular formula C22H16N8O3S2 and a molecular weight of 504.56 g/mol. Its IUPAC name is 2-[1-(4,5-dihydro-1,3-oxazol-2-yl)-5-(1,2-oxazol-3-yl)-3-(1H-pyrrol-2-yl)-2-(1,2-thiazol-3-yl)-4-(1,3-thiazol-2-yl)imidazol-2-yl]-1,3-oxazole.
| Compound Name | 2-[1-(4,5-dihydro-1,3-oxazol-2-yl)-5-(1,2-oxazol-3-yl)-3-(1H-pyrrol-2-yl)-2-(1,2-thiazol-3-yl)-4-(1,3-thiazol-2-yl)imidazol-2-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 141183862 |
| Molecular Formula | C22H16N8O3S2 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-[1-(4,5-dihydro-1,3-oxazol-2-yl)-5-(1,2-oxazol-3-yl)-3-(1H-pyrrol-2-yl)-2-(1,2-thiazol-3-yl)-4-(1,3-thiazol-2-yl)imidazol-2-yl]-1,3-oxazole |
| SMILES | c1c[nH]c(N2C(c3nccs3)=C(c3ccon3)N(C3=NCCO3)C2(c2ccsn2)c2ncco2)c1 |
| InChI | InChI=1S/C22H16N8O3S2/c1-2-16(23-5-1)29-18(19-24-8-13-34-19)17(14-3-9-33-27-14)30(21-26-7-11-32-21)22(29,15-4-12-35-28-15)20-25-6-10-31-20/h1-6,8-10,12-13,23H,7,11H2 |
| InChIKey | MIFNKGLYSDLJIM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |