C17H15N3O3 — CID 141184930
4,5-dimethoxy-15-methyl-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-8-one (PubChem CID 141184930) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 4,5-dimethoxy-15-methyl-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-8-one.
| Compound Name | 4,5-dimethoxy-15-methyl-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-8-one |
|---|---|
| PubChem CID | 141184930 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4,5-dimethoxy-15-methyl-9,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,12,14,16-heptaen-8-one |
| SMILES | COc1cc2c(=O)[nH]c3c(nc4c(C)cccn43)c2cc1OC |
| InChI | InChI=1S/C17H15N3O3/c1-9-5-4-6-20-15(9)18-14-10-7-12(22-2)13(23-3)8-11(10)17(21)19-16(14)20/h4-8H,1-3H3,(H,19,21) |
| InChIKey | LVFLTKAZEKZFGE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |