C8H14N2 — CID 141185006
N,2,2-trimethyl-1,4-dihydropyridin-3-imine (PubChem CID 141185006) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N,2,2-trimethyl-1,4-dihydropyridin-3-imine.
| Compound Name | N,2,2-trimethyl-1,4-dihydropyridin-3-imine |
|---|---|
| PubChem CID | 141185006 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N,2,2-trimethyl-1,4-dihydropyridin-3-imine |
| SMILES | C/N=C1\CC=CNC1(C)C |
| InChI | InChI=1S/C8H14N2/c1-8(2)7(9-3)5-4-6-10-8/h4,6,10H,5H2,1-3H3/b9-7+ |
| InChIKey | FZBUNWDOEXLYMV-VQHVLOKHSA-N |
| XLogP | 1.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|