C16H10F6N4 — CID 141185347
2-imidazol-1-yl-4-[3-methyl-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidine (PubChem CID 141185347) has the molecular formula C16H10F6N4 and a molecular weight of 372.27 g/mol. Its IUPAC name is 2-imidazol-1-yl-4-[3-methyl-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-imidazol-1-yl-4-[3-methyl-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 141185347 |
| Molecular Formula | C16H10F6N4 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-imidazol-1-yl-4-[3-methyl-4-(trifluoromethyl)phenyl]-6-(trifluoromethyl)pyrimidine |
| SMILES | Cc1cc(-c2cc(C(F)(F)F)nc(-n3ccnc3)n2)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H10F6N4/c1-9-6-10(2-3-11(9)15(17,18)19)12-7-13(16(20,21)22)25-14(24-12)26-5-4-23-8-26/h2-8H,1H3 |
| InChIKey | LAHBQYDZQGWLHK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |