C20H22N2O5 — CID 141185578
5-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1H-pyrazole (PubChem CID 141185578) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1H-pyrazole.
| Compound Name | 5-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1H-pyrazole |
|---|---|
| PubChem CID | 141185578 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)-1H-pyrazole |
| SMILES | COc1ccc(-c2[nH]ncc2-c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H22N2O5/c1-23-15-7-6-12(8-16(15)24-2)19-14(11-21-22-19)13-9-17(25-3)20(27-5)18(10-13)26-4/h6-11H,1-5H3,(H,21,22) |
| InChIKey | MMMIKGSUWQQDEZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |